(2,4,6-Trimethylphenyl)gold

(2,4,6-Trimethylphenyl)gold

Pentameric form
Names
IUPAC name (2,4,6-Trimethylphenyl)gold
Other names Mesitylgold; Mesitylgold(I); (2,4,6-Trimethylphenyl)gold(I)
Identifiers
CAS Number	89359-21-7 monomer N 89340-02-3 pentamer Y
3D model (Jmol)	Interactive image Interactive image
ChemSpider	14451398 Y
PubChem	19877937
InChI InChI=1S/C9H11.Au/c1-7-4-8(2)6-9(3)5-7;/h4-5H,1-3H3; Y Key: VUMCLWYYCJSHBH-UHFFFAOYSA-N Y
SMILES Cc1cc(C)c([Au])c(C)c1 CC1=CC(C)=C([Au])C(C)=C1
Properties
Chemical formula	Au 5C 45H 55
Molar mass	316.15 g mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is YN ?)
Infobox references

(2,4,6-Trimethylphenyl)gold is a member of a special group of compounds where an aryl carbon atom acts as a bridge between two gold atoms. This compound is formed in a reaction between Au(CO)Cl and mesityl Grignard.^[1] It crystallizes as a cyclical pentamer.^[1]

References